Name | Value |
---|---|
InChI=1S/C20H19NO5/c1-21-5-4-13-7-18-19(25-10-24-18)8-14(13)16(22)6-12-2-3-17-20(15(12)9-21)26-11-23-17/h2-3,7-8H,4-6,9-11H2,1H3 | |
GPTFURBXHJWNHR-UHFFFAOYSA-N | |
C20H19NO5 | |
353.12632270800003 | |
O=C1C2=CC=3OCOC3C=C2CCN(C)CC4=C5OCOC5=CC=C4C1 |
External Identifier | Value |
---|---|
130-86-9 | |
4799 | |
4970 |
Name | Value |
---|---|
BML00237 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 0.596 | |
353.126323 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
10 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
4.379 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
positive | |
0.6680304531303917 | |
0.2785903374131901 | |
354.1336 | |
[M+H]+ | |
1.9560640391958335 ppm | |
-6.927080000309616E-4 Da |