Name | Value |
---|---|
InChI=1S/C22H23NO7/c1-23-8-7-11-9-14-20(29-10-28-14)21(27-4)15(11)17(23)18-12-5-6-13(25-2)19(26-3)16(12)22(24)30-18/h5-6,9,17-18H,7-8,10H2,1-4H3/t17-,18+/m1/s1 | |
AKNNEGZIBPJZJG-MSOLQXFVSA-N | |
C22H23NO7 | |
413.14745207600004 | |
O=C1OC(C2=CC=C(OC)C(OC)=C12)C3C4=C(OC)C=5OCOC5C=C4CCN3C |
External Identifier | Value |
---|---|
128-62-1 | |
242139 | |
275196 |
Name | Value |
---|---|
BML00289 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 0.725 | |
413.147452 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
20 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
5.352 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
positive | |
1.9919753202652541 | |
0.6188419276306868 | |
414.1548 | |
[M+H]+ | |
1.5020374024719598 ppm | |
-6.220760000132941E-4 Da |