Name | Value |
---|---|
InChI=1S/C20H31N/c1-14(2)15-6-8-17-16(12-15)7-9-18-19(3,13-21)10-5-11-20(17,18)4/h6,8,12,14,18H,5,7,9-11,13,21H2,1-4H3 | |
JVVXZOOGOGPDRZ-UHFFFAOYSA-N | |
C20H31N | |
285.245649992 | |
NCC1(C)CCCC2(C3=CC=C(C=C3CCC21)C(C)C)C |
External Identifier | Value |
---|---|
1446-61-3 | |
96133 | |
106831 |
Name | Value |
---|---|
BML00363 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 1.136 | |
285.24565 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
20 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
8.34 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
positive | |
2.021714170754399 | |
0.6003969573301553 | |
286.2529 | |
[M+H]+ | |
2.5152304132886707 ppm | |
-7.199919999720805E-4 Da |