Name | Value |
---|---|
InChI=1S/C20H36O2/c1-7-18(4,21)13-9-16-19(5)12-8-11-17(2,3)15(19)10-14-20(16,6)22/h7,15-16,21-22H,1,8-14H2,2-6H3/t15-,16+,18-,19-,20+/m0/s1 | |
XVULBTBTFGYVRC-HHUCQEJWSA-N | |
C20H36O2 | |
308.271530392 | |
OC(C=C)(C)CCC1C(O)(C)CCC2C(C)(C)CCCC12C |
External Identifier | Value |
---|---|
515-03-7 | |
143282 | |
163263 |
Name | Value |
---|---|
BML00422 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 1.471 | |
308.27153 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
20 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
10.813 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
positive | |
0.0 | |
NaN | |
331.2607 | |
[M+Na]+ | |
1.8124456056028695 ppm | |
-6.003920000239304E-4 Da |