Name | Value |
---|---|
InChI=1S/C15H16O9/c16-5-10-12(19)13(20)14(21)15(24-10)23-9-3-6-1-2-11(18)22-8(6)4-7(9)17/h1-4,10,12-17,19-21H,5H2 | |
XHCADAYNFIFUHF-UHFFFAOYSA-N | |
C15H16O9 | |
340.079432092 | |
O=C1OC=2C=C(O)C(OC3OC(CO)C(O)C(O)C3O)=CC2C=C1 |
External Identifier | Value |
---|---|
531-75-9 | |
4508522 | |
5351506 |
Name | Value |
---|---|
BML00511 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 0.385 | |
340.079432 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
40 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
2.834 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
negative | |
1.2367795944084377 | |
0.49771672288532587 | |
339.0721 | |
[M-H]- | |
0.16542794297302876 ppm | |
-5.609200002254511E-5 Da |