Name | Value |
---|---|
C12H18O3 | |
210.12559443599997 | |
O=C(O)CC1CCC(=O)C1CC=CCC | |
InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3+ | |
ZNJFBWYDHIGLCU-ONEGZZNKSA-N |
External Identifier | Value |
---|---|
77026-92-7 | |
484866 | |
557758 |
Name | Value |
---|---|
BML00646 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 0.910 | |
210.125594 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
10 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
6.707 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
positive | |
2.279835289549381 | |
0.8418733480721516 | |
211.1329 | |
[M+H]+ | |
3.1470036169894056 ppm | |
-6.644359999654625E-4 Da |