Name | Value |
---|---|
InChI=1S/C13H16N2O2/c1-9(16)14-6-5-10-8-15-13-4-3-11(17-2)7-12(10)13/h3-4,7-8,15H,5-6H2,1-2H3,(H,14,16) | |
DRLFMBDRBRZALE-UHFFFAOYSA-N | |
C13H16N2O2 | |
232.121177752 | |
OC(=NCCC1=CNC=2C=CC(OC)=CC21)C |
External Identifier | Value |
---|---|
73-31-4 | |
873 | |
896 |
Name | Value |
---|---|
BML00698 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 0.682 | |
232.121178 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
10 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
5.018 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
positive | |
0.9950057375587122 | |
0.3511933683519209 | |
233.1285 | |
[M+H]+ | |
2.7785191428413807 ppm | |
-6.477519999918968E-4 Da |