Name | Value |
---|---|
C9H8O4 | |
180.042258736 | |
O=C(O)C=CC1=CC=C(O)C(O)=C1 | |
InChI=1S/C9H8O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5,10-11H,(H,12,13)/b4-2+ | |
QAIPRVGONGVQAS-DUXPYHPUSA-N |
External Identifier | Value |
---|---|
331-39-5 | |
2423 | |
2518 |
Name | Value |
---|---|
2.971 | |
BML00729 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 0.403 | |
180.042259 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
20 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
negative | |
0.8000241870782315 | |
0.3336359999344735 | |
179.035 | |
[M-H]- | |
0.09642807260548264 ppm | |
1.7263999978922584E-5 Da |