Name | Value |
---|---|
InChI=1S/C16H12O5/c1-20-11-4-2-9(3-5-11)14-8-13(19)16-12(18)6-10(17)7-15(16)21-14/h2-8,17-18H,1H3 | |
DANYIYRPLHHOCZ-UHFFFAOYSA-N | |
C16H12O5 | |
284.068473484 | |
O=C1C=C(OC=2C=C(O)C=C(O)C12)C=3C=CC(OC)=CC3 |
External Identifier | Value |
---|---|
480-44-4 | |
4444099 | |
5280442 |
Name | Value |
---|---|
BML00818 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 1.223 | |
284.068473 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
10 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
8.97 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
positive | |
0.20055195347818602 | |
0.1825502550324855 | |
285.0758 | |
[M+H]+ | |
2.257238250197353 ppm | |
-6.434839999656106E-4 Da |