Name | Value |
---|---|
InChI=1S/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19) | |
DKYWVDODHFEZIM-UHFFFAOYSA-N | |
C16H14O3 | |
254.094294308 | |
O=C(O)C(C=1C=CC=C(C1)C(=O)C=2C=CC=CC2)C |
External Identifier | Value |
---|---|
22071-15-4 | |
3693 | |
3825 |
Name | Value |
---|---|
BML00836 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 1.071 | |
254.094294 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
40 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
7.85 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
positive | |
1.0349783899426395 | |
0.7465790952987449 | |
255.1016 | |
[M+H]+ | |
2.604091859916658 ppm | |
-6.643080000117152E-4 Da |