Name | Value |
---|---|
InChI=1S/C21H26N2O3/c1-26-21(25)19-15-10-17-20-14(13-4-2-3-5-16(13)22-20)8-9-23(17)11-12(15)6-7-18(19)24/h2-5,12,15,17-19,22,24H,6-11H2,1H3/t12-,15-,17-,18-,19+/m0/s1 | |
BLGXFZZNTVWLAY-SCYLSFHTSA-N | |
C21H26N2O3 | |
354.19434269199996 | |
O=C(OC)C1C(O)CCC2CN3CCC=4C=5C=CC=CC5NC4C3CC12 |
External Identifier | Value |
---|---|
146-48-5 | |
8622 | |
8969 |
Name | Value |
---|---|
BML00930 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 0.553 | |
354.194 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
40 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
4.06 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
positive | |
2.072541355631452 | |
0.5657176146663123 | |
355.2022 | |
[M+H]+ | |
0.3172615483778666 ppm | |
-1.1269199995922463E-4 Da |