Name | Value |
---|---|
InChI=1S/C28H40N2O9/c1-6-7-8-9-11-20-25(39-22(32)14-16(2)3)18(5)38-28(36)23(17(4)37-27(20)35)30-26(34)19-12-10-13-21(24(19)33)29-15-31/h10,12-13,15-18,20,23,25,33H,6-9,11,14H2,1-5H3,(H,29,31)(H,30,34) | |
UIFFUZWRFRDZJC-UHFFFAOYSA-N | |
C28H40N2O9 | |
548.27338086 | |
O=C(OC1C(OC(=O)C(N=C(O)C=2C=CC=C(N=CO)C2O)C(OC(=O)C1CCCCCC)C)C)CC(C)C |
External Identifier | Value |
---|---|
642-15-9 | |
12032 | |
12550 |
Name | Value |
---|---|
BML00955 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 1.579 | |
548.273381 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
40 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
11.631 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
negative | |
2.5622793495753284 | |
0.5708369176111793 | |
547.2661 | |
[M-H]- | |
0.008880505984778846 ppm | |
-4.859999876316579E-6 Da |