Name | Value |
---|---|
InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11) | |
HNDVDQJCIGZPNO-UHFFFAOYSA-N | |
C6H9N3O2 | |
155.069476528 | |
O=C(O)C(N)CC1=CN=CN1 |
External Identifier | Value |
---|---|
71-00-1 | |
752 | |
773 |
Name | Value |
---|---|
BML01070 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 0.043 | |
155.069477 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
10 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
0.32 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
positive | |
0.7709303413374834 | |
0.7017310376821946 | |
156.0768 | |
[M+H]+ | |
4.142370935362011 ppm | |
-6.465280000043094E-4 Da |