Name | Value |
---|---|
InChI=1S/C24H40O3/c1-15(4-9-22(26)27)19-7-8-20-18-6-5-16-14-17(25)10-12-23(16,2)21(18)11-13-24(19,20)3/h15-21,25H,4-14H2,1-3H3,(H,26,27) | |
SMEROWZSTRWXGI-UHFFFAOYSA-N | |
C24H40O3 | |
376.29774513999996 | |
O=C(O)CCC(C)C1CCC2C3CCC4CC(O)CCC4(C)C3CCC12C |
External Identifier | Value |
---|---|
434-13-9 | |
437560 | |
500165 |
Name | Value |
---|---|
BML01099 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 1.575 | |
376.297745 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
10 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
11.556 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
negative | |
0.32817828501000307 | |
0.1831597882674466 | |
375.2904 | |
[M-H]- | |
0.1842306650894742 ppm | |
-6.91399999936948E-5 Da |