Name | Value |
---|---|
InChI=1S/C15H10O4/c1-7-5-9-13(11(17)6-7)15(19)12-8(14(9)18)3-2-4-10(12)16/h2-6,16-17H,1H3 | |
LQGUBLBATBMXHT-UHFFFAOYSA-N | |
C15H10O4 | |
254.0579088 | |
O=C1C=2C=CC=C(O)C2C(=O)C3=C(O)C=C(C=C13)C |
External Identifier | Value |
---|---|
481-74-3 | |
9793 | |
10208 |
Name | Value |
---|---|
BML01172 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 1.318 | |
254.057909 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
20 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
9.711 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
negative | |
1.2433686396125254 | |
0.5399881391552727 | |
253.0506 | |
[M-H]- | |
0.12961834516030302 ppm | |
-3.280000001382177E-5 Da |