Name | Value |
---|---|
InChI=1S/C11H17N3O4/c1-11(2,3)18-10(17)14-8(9(15)16)4-7-5-12-6-13-7/h5-6,8H,4H2,1-3H3,(H,12,13)(H,14,17)(H,15,16) | |
AYMLQYFMYHISQO-UHFFFAOYSA-N | |
C11H17N3O4 | |
255.121906024 | |
O=C(O)C(N=C(O)OC(C)(C)C)CC1=CN=CN1 |
External Identifier | Value |
---|---|
17791-52-5 | |
295527 | |
333506 |
Name | Value |
---|---|
BML01479 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 0.276 | |
255.121906 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
20 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
2.041 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
positive | |
0.5055806221274713 | |
0.7293986563128598 | |
256.1292 | |
[M+H]+ | |
2.6393866844238403 ppm | |
-6.760239999721307E-4 Da |