Name | Value |
---|---|
InChI=1S/C17H14O8/c1-23-11-5-7(3-4-8(11)18)15-14(22)13(21)12-9(19)6-10(20)16(24-2)17(12)25-15/h3-6,18-20,22H,1-2H3 | |
IBXCKSUZOFKGSB-UHFFFAOYSA-N | |
C17H14O8 | |
346.068867408 | |
O=C1C(O)=C(OC=2C(OC)=C(O)C=C(O)C12)C=3C=CC(O)=C(OC)C3 |
External Identifier | Value |
---|---|
489-33-8 | |
4590163 | |
5489485 |
Name | Value |
---|---|
BML01635 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 1.072 | |
346.068867 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
40 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
7.905 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
negative | |
3.86518341251885 | |
0.919254690507842 | |
345.0616 | |
[M-H]- | |
0.02489990184923742 ppm | |
8.591999971940822E-6 Da |