Name | Value |
---|---|
InChI=1S/C13H13NO2/c14-12(13(15)16)8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7,12H,8,14H2,(H,15,16) | |
JPZXHKDZASGCLU-UHFFFAOYSA-N | |
C13H13NO2 | |
215.094628656 | |
O=C(O)C(N)CC=1C=CC=2C=CC=CC2C1 |
External Identifier | Value |
---|---|
76985-09-6 | |
219298 | |
250399 |
Name | Value |
---|---|
BML01675 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 0.471 | |
215.094629 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
10 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
3.443 | |
water with 0.2% acetic acid | |
negative | |
methanol with 0.2% acetic acid | |
1.6889299893986456 | |
0.6399747252345104 | |
214.0873 | |
[M-H]- | |
0.24595573865547105 ppm | |
-5.265600000825543E-5 Da |