Name | Value |
---|---|
InChI=1S/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-16,18,22,24,26H,3-8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1 | |
JYGXADMDTFJGBT-VWUMJDOOSA-N | |
C21H30O5 | |
362.20932406 | |
O=C1C=C2CCC3C4CCC(O)(C(=O)CO)C4(C)CC(O)C3C2(C)CC1 |
External Identifier | Value |
---|---|
50-23-7 80562-38-5 | |
17650 | |
5551 | |
HMDB00063 | |
C00735 | |
LMST02030001 | |
5754 |
Name | Value |
---|---|
BML81440 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 1.008 | |
362.20932 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS1 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
7.353 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
positive | |
0.5047923080645452 | |
0.7282613595236133 |