Name | Value |
---|---|
InChI=1S/C45H53NO14/c1-9-23(2)39(52)46-33(27-16-12-10-13-17-27)34(50)41(54)58-29-21-45(55)38(59-40(53)28-18-14-11-15-19-28)36-43(8,30(49)20-31-44(36,22-56-31)60-26(5)48)37(51)35(57-25(4)47)32(24(29)3)42(45,6)7/h9-19,29-31,33-36,38,49-50,55H,20-22H2,1-8H3,(H,46,52)/b23-9+/t29-,30-,31+,33-,34+,35+,36?,38-,43+,44-,45+/m0/s1 | |
DBXFAPJCZABTDR-UJLUYDJNSA-N | |
C45H53NO14 | |
831.346605376 | |
O=C(OC1C2C3(OC(=O)C)COC3CC(O)C2(C(=O)C(OC(=O)C)C4=C(C)C(OC(=O)C(O)C(N=C(O)C(=CC)C)C=5C=CC=CC5)CC1(O)C4(C)C)C)C=6C=CC=CC6 |
External Identifier | Value |
---|---|
71610-00-9 | |
4445130 | |
5281819 |
Name | Value |
---|---|
BML82403 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 1.172 | |
831.346605 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-APCI-QTOF | |
MS1 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
8.665 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
negative | |
0.0 | |
NaN |