Name | Value |
---|---|
Natural Product; Antibiotic | |
InChI=1S/C37H67NO13/c1-14-25-37(10,45)30(41)20(4)27(39)18(2)16-35(8,44)32(51-34-28(40)24(38(11)12)15-19(3)47-34)21(5)29(22(6)33(43)49-25)50-26-17-36(9,46-13)31(42)23(7)48-26/h18-26,28-32,34,40-42,44-45H,14-17H2,1-13H3/t18-,19-,20+,21+,22-,23+,24+,25-,26+,28-,29+,30-,31+,32-,34+,35-,36-,37-/m1/s1 | |
ULGZDMOVFRHVEP-RWJQBGPGSA-N | |
C37H67NO13 | |
733.4612412040001 | |
O=C1OC(CC)C(O)(C)C(O)C(C(=O)C(C)CC(O)(C)C(OC2OC(C)CC(N(C)C)C2O)C(C)C(OC3OC(C)C(O)C(OC)(C)C3)C1C)C |
External Identifier | Value |
---|---|
12560 |
Name | Value |
---|---|
CE000003 | |
2016.01.19 (Created 2012.04.11) | |
Ales Svatos, Ravi Kumar Maddula, MPI for Chemical Ecology, Jena, Germany | |
CC BY-NC-SA | |
Copyright(C) 2011 MPI for Chemical Ecology, Jena, Germany | |
F. Rasche, A. Svatos, R.K. Maddula, C. Boettcher and S. Boecker. Computing fragmentation trees from tandem mass spectrometry data. Anal. Chem., 2011, 83, 1243-1251 doi:10.1021/ac101825k | |
Acquisition and generation of the data is financially supported by the Max-Planck-Society | |
733.46124 | |
LTQ Orbitrap XL, Thermo Scientfic; HP-1100 HPLC, Agilent | |
LC-ESI-ITFT | |
MS2 | |
q=0.25 | |
30 ms | |
300000.0 | |
275 C | |
39 V | |
55eV | |
CID | |
ESI | |
7500 | |
4.5 kV | |
140 V | |
Symmetry C18 Column, Waters | |
0min:5%, 24min:95%, 28min:95%, 28.1:5% (acetonitrile) | |
0.3 ml/min | |
674.82 s | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
positive | |
1.9018018298369193 | |
0.91457335621976 | |
734.46852 | |
[M+H]+ | |
0.9410941126204433 ppm | |
-6.912040000770503E-4 Da |