Name | Value |
---|---|
Natural Product; Antibiotics | |
C43H58N4O12 | |
822.405123296 | |
O=C(OC1C(C)C(OC)C=COC2(OC3=C(C2=O)C=4C(=O)C(=CNN5CCN(C)CC5)C(N=C(O)C(=CC=CC(C)C(O)C(C)C(O)C1C)C)=C(O)C4C(O)=C3C)C)C | |
InChI=1S/C43H58N4O12/c1-21-12-11-13-22(2)42(55)45-33-28(20-44-47-17-15-46(9)16-18-47)37(52)30-31(38(33)53)36(51)26(6)40-32(30)41(54)43(8,59-40)57-19-14-29(56-10)23(3)39(58-27(7)48)25(5)35(50)24(4)34(21)49/h11-14,19-21,23-25,29,34-35,39,44,49-51,53H,15-18H2,1-10H3,(H,45,55)/b12-11+,19-14+,22-13?,28-20+/t21-,23+,24+,25+,29-,34-,35+,39+,43-/m0/s1 | |
FZYOVNIOYYPUPY-YVRGJHRRSA-N |
External Identifier | Value |
---|---|
5381226 |
Name | Value |
---|---|
4.5 kV | |
CE000181 | |
2016.01.19 (Created 2012.04.11) | |
Ales Svatos, Ravi Kumar Maddula, MPI for Chemical Ecology, Jena, Germany | |
CC BY-NC-SA | |
Copyright(C) 2011 MPI for Chemical Ecology, Jena, Germany | |
F. Rasche, A. Svatos, R.K. Maddula, C. Boettcher and S. Boecker. Computing fragmentation trees from tandem mass spectrometry data. Anal. Chem., 2011, 83, 1243-1251 doi:10.1021/ac101825k | |
Acquisition and generation of the data is financially supported by the Max-Planck-Society | |
822.40513 | |
LTQ Orbitrap XL, Thermo Scientfic; HP-1100 HPLC, Agilent | |
LC-ESI-ITFT | |
MS2 | |
q=0.25 | |
30 ms | |
300000.0 | |
275 C | |
39 V | |
35eV | |
CID | |
ESI | |
7500 | |
140 V | |
Symmetry C18 Column, Waters | |
0min:5%, 24min:95%, 28min:95%, 28.1:5% (acetonitrile) | |
0.3 ml/min | |
908.324 s | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
positive | |
0.5860584484468166 | |
0.19563111617833107 | |
823.41241 | |
[M+H]+ | |
0.8298344690163295 ppm | |
-6.832960000338062E-4 Da |