Name | Value |
---|---|
Natural Product; Benzopyrans | |
InChI=1S/C27H32O14/c1-10-20(32)22(34)24(36)26(37-10)41-25-23(35)21(33)18(9-28)40-27(25)38-13-6-14(30)19-15(31)8-16(39-17(19)7-13)11-2-4-12(29)5-3-11/h2-7,10,16,18,20-30,32-36H,8-9H2,1H3/t10-,16-,18+,20-,21+,22+,23-,24+,25+,26-,27+/m0/s1 | |
DFPMSGMNTNDNHN-ZPHOTFPESA-N | |
C27H32O14 | |
580.179205704 | |
O=C1C2=C(O)C=C(OC3OC(CO)C(O)C(O)C3OC4OC(C)C(O)C(O)C4O)C=C2OC(C5=CC=C(O)C=C5)C1 |
External Identifier | Value |
---|---|
442428 |
Name | Value |
---|---|
CE000190 | |
2016.01.19 (Created 2012.04.11) | |
Ales Svatos, Ravi Kumar Maddula, MPI for Chemical Ecology, Jena, Germany | |
CC BY-NC-SA | |
Copyright(C) 2011 MPI for Chemical Ecology, Jena, Germany | |
F. Rasche, A. Svatos, R.K. Maddula, C. Boettcher and S. Boecker. Computing fragmentation trees from tandem mass spectrometry data. Anal. Chem., 2011, 83, 1243-1251 doi:10.1021/ac101825k | |
Acquisition and generation of the data is financially supported by the Max-Planck-Society | |
580.17921 | |
LTQ Orbitrap XL, Thermo Scientfic; HP-1100 HPLC, Agilent | |
LC-ESI-ITFT | |
MS1 | |
300000.0 | |
275 C | |
39 V | |
ESI | |
7500 | |
4.5 kV | |
140 V | |
Symmetry C18 Column, Waters | |
0min:5%, 24min:95%, 28min:95%, 28.1:5% (acetonitrile) | |
0.3 ml/min | |
630.222 s | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
positive | |
0.7604469669948561 | |
0.5485465340712661 |