Name | Value |
---|---|
Natural Product; Zeatin | |
InChI=1S/C21H31N5O10/c1-9(6-34-21-17(33)15(31)13(29)11(5-28)36-21)2-3-22-18-12-19(24-7-23-18)26(8-25-12)20-16(32)14(30)10(4-27)35-20/h2,7-8,10-11,13-17,20-21,27-33H,3-6H2,1H3,(H,22,23,24)/b9-2+/t10-,11-,13-,14-,15+,16-,17-,20-,21-/m1/s1 | |
MVMBTNNVZQRZQT-BPDSZQNASA-N | |
C21H31N5O10 | |
513.207092192 | |
OCC1OC(OCC(=CCNC2=NC=NC3=C2N=CN3C4OC(CO)C(O)C4O)C)C(O)C(O)C1O |
External Identifier | Value |
---|---|
11713250 |
Name | Value |
---|---|
CE000223 | |
2016.01.19 (Created 2012.04.12) | |
Ales Svatos, Marco Kai, Ravi Kumar Maddula, MPI for Chemical Ecology, Jena, Germany | |
CC BY-NC-SA | |
Copyright(C) 2011 MPI for Chemical Ecology, Jena, Germany | |
F. Rasche, K. Scheubert, F. Hufsky, T. Zichner, M. Kai, A. Svatos and S. Boecker. Identifying the unknowns by aligning fragmentation trees. Anal. Chem., 2012, 84, 3417-3426 doi:10.1021/ac300304u | |
Acquisition and generation of the data is financially supported by the Max-Planck-Society | |
513.2071 | |
LTQ Orbitrap XL, Thermo Scientfic; HP-1100 HPLC, Agilent | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
7500 | |
4.5 kV | |
140 V | |
300000.0 | |
275 C | |
39 V | |
CID | |
30 ms | |
q=0.25 | |
20.0eV | |
Symmetry C18 Column, Waters | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
0min:5%, 24min:95%, 28min:95%, 28.1:5% (acetonitrile) | |
0.3 ml/min | |
6.7798 s | |
positive | |
0.8735691120333905 | |
0.33101558735775777 | |
514.21438 | |
[M+H]+ | |
1.3266684607289752 ppm | |
-6.821919999993042E-4 Da |