Name | Value |
---|---|
InChI=1S/C12H13N5O6S2/c1-6-13-10(16-12(14-6)23-3)15-11(19)17-25(20,21)7-4-5-24-8(7)9(18)22-2/h4-5H,1-3H3,(H2,13,14,15,16,17,19) | |
AHTPATJNIAFOLR-UHFFFAOYSA-N | |
C12H13N5O6S2 | |
387.030725136 | |
O=C(OC)C=1SC=CC1S(=O)(=O)N=C(O)N=C2N=C(N=C(OC)N2)C |
External Identifier | Value |
---|---|
79277-27-3 | |
C10957 | |
73674 | |
66325 |
Name | Value |
---|---|
EA012458 | |
2014.01.14 | |
Stravs M, Schymanski E, Singer H, Department of Environmental Chemistry, Eawag | |
CC BY | |
Copyright (C) 2012 Eawag, Duebendorf, Switzerland | |
387.0307 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
15 % (nominal) | |
15000 | |
XBridge C18 3.5um, 2.1x50mm, Waters | |
90/10 at 0 min, 50/50 at 4 min, 5/95 at 17 min, 5/95 at 25 min, 90/10 at 25.1 min, 90/10 at 30 min | |
200 ul/min | |
6.9 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
Spline | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.3.1 | |
negative | |
0.6887718321956782 | |
0.3844108788175805 | |
386.0234 | |
[M-H]- | |
0.12728762046458358 ppm | |
-4.913600002964813E-5 Da |