Name | Value |
---|---|
InChI=1S/C9H11ClN2O/c1-12(2)9(13)11-8-5-3-7(10)4-6-8/h3-6H,1-2H3,(H,11,13) | |
BMLIZLVNXIYGCK-UHFFFAOYSA-N | |
C9H11ClN2O | |
198.055990652 | |
O=C(NC1=CC=C(Cl)C=C1)N(C)C |
External Identifier | Value |
---|---|
150-68-5 | |
38214 | |
8800 | |
8470 |
Name | Value |
---|---|
EA016105 | |
2014.01.14 | |
Stravs M, Schymanski E, Singer H, Department of Environmental Chemistry, Eawag | |
CC BY | |
Copyright (C) 2012 Eawag, Duebendorf, Switzerland | |
198.0554 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
60 % (nominal) | |
7500 | |
XBridge C18 3.5um, 2.1x50mm, Waters | |
90/10 at 0 min, 50/50 at 4 min, 5/95 at 17 min, 5/95 at 25 min, 90/10 at 25.1 min, 90/10 at 30 min | |
200 ul/min | |
6.7 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
Spline | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.3.1 | |
positive | |
0.5059778333131532 | |
0.4605608716852873 | |
199.0633 | |
[M+H]+ | |
3.3188036167060098 ppm | |
-6.606519999934335E-4 Da |