Name | Value |
---|---|
InChI=1S/C16H28N2O4/c1-5-12(6-2)22-14-9-11(16(20)21-7-3)8-13(17)15(14)18-10(4)19/h9,12-15H,5-8,17H2,1-4H3,(H,18,19)/t13-,14+,15+/m0/s1 | |
VSZGPKBBMSAYNT-RRFJBIMHSA-N | |
C16H28N2O4 | |
312.204907376 | |
O=C(OCC)C1=CC(OC(CC)CC)C(N=C(O)C)C(N)C1 |
External Identifier | Value |
---|---|
196618-13-0 | |
7798 | |
C08092 | |
65028 | |
58540 |
Name | Value |
---|---|
EA065803 | |
2014.01.14 | |
Stravs M, Schymanski E, Singer H, Department of Environmental Chemistry, Eawag | |
CC BY | |
Copyright (C) 2012 Eawag, Duebendorf, Switzerland | |
312.2049 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
30 % (nominal) | |
7500 | |
XBridge C18 3.5um, 2.1x50mm, Waters | |
90/10 at 0 min, 50/50 at 4 min, 5/95 at 17 min, 5/95 at 25 min, 90/10 at 25.1 min, 90/10 at 30 min | |
200 ul/min | |
7.0 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
Spline | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.3.1 | |
positive | |
2.104258486477371 | |
0.6018172274722089 | |
313.2122 | |
[M+H]+ | |
2.1626743785801783 ppm | |
-6.773759999987305E-4 Da |