Name | Value |
---|---|
InChI=1S/C13H18ClNO2/c1-10-5-4-6-11(2)13(10)15(7-8-17-3)12(16)9-14/h4-6H,7-9H2,1-3H3 | |
SCCDDNKJYDZXMM-UHFFFAOYSA-N | |
C13H18ClNO2 | |
255.102606496 | |
O=C(N(C=1C(=CC=CC1C)C)CCOC)CCl |
External Identifier | Value |
---|---|
50563-36-5 | |
39722 | |
36319 |
Name | Value |
---|---|
EA070705 | |
2014.01.14 | |
Stravs M, Schymanski E, Singer H, Department of Environmental Chemistry, Eawag | |
CC BY | |
Copyright (C) 2012 Eawag, Duebendorf, Switzerland | |
255.1021 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
60 % (nominal) | |
7500 | |
XBridge C18 3.5um, 2.1x50mm, Waters | |
90/10 at 0 min, 50/50 at 4 min, 5/95 at 17 min, 5/95 at 25 min, 90/10 at 25.1 min, 90/10 at 30 min | |
200 ul/min | |
9.1 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
Spline | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.3.1 | |
positive | |
1.3914924984913397 | |
0.44378729561106683 | |
256.1099 | |
[M+H]+ | |
2.6414285429136575 ppm | |
-6.764959999827624E-4 Da |