Name | Value |
---|---|
InChI=1S/C17H19NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,13,16,19-20H,6-8H2,1H3/t10-,11+,13-,16-,17-/m0/s1 | |
BQJCRHHNABKAKU-KBQPJGBKSA-N | |
C17H19NO3 | |
285.13649346799997 | |
OC1=CC=C2C3=C1OC4C(O)C=CC5C(N(C)CCC345)C2 |
External Identifier | Value |
---|---|
57-27-2 | |
17303 | |
4450907 | |
C01516 | |
5288826 |
Name | Value |
---|---|
EA274414 | |
2014.01.14 | |
Stravs M, Schymanski E, Singer H, Department of Environmental Chemistry, Eawag | |
CC BY | |
Copyright (C) 2012 Eawag, Duebendorf, Switzerland | |
285.1364935 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 % (nominal) | |
30000 | |
XBridge C18 3.5um, 2.1x50mm, Waters | |
90/10 at 0 min, 50/50 at 4 min, 5/95 at 17 min, 5/95 at 25 min, 90/10 at 25.1 min, 90/10 at 30 min | |
200 ul/min | |
1.1 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
Spline | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.3.1 | |
positive | |
2.8928352609789596 | |
0.6982237972016124 | |
286.1438 | |
[M+H]+ | |
2.3186523697897172 ppm | |
-6.63467999970635E-4 Da |