Name | Value |
---|---|
InChI=1S/C9H13ClN6/c1-4-12-7-13-6(10)14-8(15-7)16-9(2,3)5-11/h4H2,1-3H3,(H2,12,13,14,15,16) | |
MZZBPDKVEFVLFF-UHFFFAOYSA-N | |
C9H13ClN6 | |
240.08902209599998 | |
N#CC(NC1=NC(Cl)=NC(=NCC)N1)(C)C |
External Identifier | Value |
---|---|
21725-46-2 | |
38069 | |
C14299 | |
30773 | |
28552 |
Name | Value |
---|---|
EA275914 | |
2014.01.14 | |
Stravs M, Schymanski E, Singer H, Department of Environmental Chemistry, Eawag | |
CC BY | |
Copyright (C) 2012 Eawag, Duebendorf, Switzerland | |
240.089 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 % (nominal) | |
30000 | |
XBridge C18 3.5um, 2.1x50mm, Waters | |
90/10 at 0 min, 50/50 at 4 min, 5/95 at 17 min, 5/95 at 25 min, 90/10 at 25.1 min, 90/10 at 30 min | |
200 ul/min | |
6.6 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
Spline | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.3.1 | |
positive | |
0.6094693994528385 | |
0.2541684811537165 | |
241.0963 | |
[M+H]+ | |
2.87062057761199 ppm | |
-6.920959999661136E-4 Da |