Name | Value |
---|---|
InChI=1S/C10H24N2O2/c1-3-9(7-13)11-5-6-12-10(4-2)8-14/h9-14H,3-8H2,1-2H3/t9-,10-/m0/s1 | |
AEUTYOVWOVBAKS-UWVGGRQHSA-N | |
C10H24N2O2 | |
204.183778008 | |
OCC(NCCNC(CO)CC)CC |
External Identifier | Value |
---|---|
74-55-5 | |
C06984 | |
14052 | |
13433 |
Name | Value |
---|---|
XBridge C18 3.5um, 2.1x50mm, Waters | |
90/10 at 0 min, 50/50 at 4 min, 5/95 at 17 min, 5/95 at 25 min, 90/10 at 25.1 min, 90/10 at 30 min | |
200 ul/min | |
EA278204 | |
2014.01.14 | |
Stravs M, Schymanski E, Singer H, Department of Environmental Chemistry, Eawag | |
CC BY | |
Copyright (C) 2012 Eawag, Duebendorf, Switzerland | |
204.1838 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
45 % (nominal) | |
7500 | |
9.6 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
Spline | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.3.1 | |
positive | |
0.0 | |
NaN | |
205.1911 | |
[M+H]+ | |
3.1580706959739318 ppm | |
-6.480079999846566E-4 Da |