Name | Value |
---|---|
InChI=1S/C6H8ClN5O2S/c1-8-6(11-12(13)14)10-3-4-2-9-5(7)15-4/h2H,3H2,1H3,(H2,8,10,11) | |
PGOOBECODWQEAB-UHFFFAOYSA-N | |
C6H8ClN5O2S | |
249.008723176 | |
O=N(=O)NC(=NC)NCC=1SC(Cl)=NC1 |
External Identifier | Value |
---|---|
210880-92-5 | |
39178 | |
213027 | |
184723 |
Name | Value |
---|---|
EA293301 | |
2014.01.14 | |
Stravs M, Schymanski E, Singer H, Department of Environmental Chemistry, Eawag | |
CC BY | |
Copyright (C) 2012 Eawag, Duebendorf, Switzerland | |
249.0087 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 % (nominal) | |
7500 | |
XBridge C18 3.5um, 2.1x50mm, Waters | |
90/10 at 0 min, 50/50 at 4 min, 5/95 at 17 min, 5/95 at 25 min, 90/10 at 25.1 min, 90/10 at 30 min | |
200 ul/min | |
4.9 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
Spline | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.3.1 | |
positive | |
1.7376862466719136 | |
0.5901586886218461 | |
250.016 | |
[M+H]+ | |
2.7725265582947882 ppm | |
-6.931759999986298E-4 Da |