Name | Value |
---|---|
InChI=1S/C22H24N2O9/c1-21(32)7-5-4-6-8(25)9(7)15(26)10-12(21)17(28)13-14(24(2)3)16(27)11(20(23)31)19(30)22(13,33)18(10)29/h4-6,12-14,17,25-26,28,30,32-33H,1-3H3,(H2,23,31) | |
OWFJMIVZYSDULZ-UHFFFAOYSA-N | |
C22H24N2O9 | |
460.148180348 | |
O=C1C(C(=N)O)=C(O)C2(O)C(=O)C3=C(O)C=4C(O)=CC=CC4C(O)(C)C3C(O)C2C1N(C)C |
External Identifier | Value |
---|---|
79-57-2 | |
54686003 | |
10482174 |
Name | Value |
---|---|
EQ361004 | |
2015.08.25 | |
Stravs M, Schymanski E, Singer H, Department of Environmental Chemistry, Eawag and Thomaidis N, University of Athens | |
CC BY | |
Copyright (C) 2015 Eawag, Duebendorf, Switzerland | |
460.14818 | |
Q Exactive Plus Orbitrap Thermo Scientific | |
LC-ESI-QFT | |
MS2 | |
ESI | |
HCD | |
60 (nominal) | |
35000 | |
XBridge C18 3.5um, 2.1x50mm, Waters | |
90/10 at 0 min, 50/50 at 4 min, 5/95 at 17 min, 5/95 at 25 min, 90/10 at 25.1 min, 90/10 at 30 min | |
200 ul/min | |
4.3 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.9.6 | |
positive | |
4.093040090833717 | |
0.7557171741439281 | |
461.1555 | |
[M+H]+ | |
1.4102574944137198 ppm | |
-6.503479999651063E-4 Da |