Name | Value |
---|---|
InChI=1S/C22H24N2O8/c1-7-8-5-4-6-9(25)11(8)16(26)12-10(7)17(27)14-15(24(2)3)18(28)13(21(23)31)20(30)22(14,32)19(12)29/h4-7,10,14-15,17,25-27,30,32H,1-3H3,(H2,23,31) | |
SGKRLCUYIXIAHR-UHFFFAOYSA-N | |
C22H24N2O8 | |
444.153265728 | |
O=C1C(C(=N)O)=C(O)C2(O)C(=O)C3=C(O)C=4C(O)=CC=CC4C(C)C3C(O)C2C1N(C)C |
External Identifier | Value |
---|---|
564-25-0 | |
54681536 | |
10482106 |
Name | Value |
---|---|
EQ367807 | |
2015.08.25 | |
Stravs M, Schymanski E, Singer H, Department of Environmental Chemistry, Eawag and Thomaidis N, University of Athens | |
CC BY | |
Copyright (C) 2015 Eawag, Duebendorf, Switzerland | |
444.15327 | |
Q Exactive Plus Orbitrap Thermo Scientific | |
LC-ESI-QFT | |
MS2 | |
ESI | |
HCD | |
120 (nominal) | |
35000 | |
445.1605 | |
XBridge C18 3.5um, 2.1x50mm, Waters | |
90/10 at 0 min, 50/50 at 4 min, 5/95 at 17 min, 5/95 at 25 min, 90/10 at 25.1 min, 90/10 at 30 min | |
200 ul/min | |
6.4 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.9.6 | |
positive | |
4.099475069201357 | |
0.8048048898338341 | |
[M+H]+ | |
1.6527252530157235 ppm | |
-7.357279999951061E-4 Da |