Name | Value |
---|---|
InChI=1S/C40H68O11/c1-21-11-12-28(46-33(21)26(6)36(42)43)17-29-18-30(45-10)27(7)40(48-29)25(5)19-38(9,51-40)32-13-14-37(8,49-32)35-23(3)16-31(47-35)34-22(2)15-24(4)39(44,20-41)50-34/h21-35,41,44H,11-20H2,1-10H3,(H,42,43) | |
DANUORFCFTYTSZ-UHFFFAOYSA-N | |
C40H68O11 | |
724.476162996 | |
O=C(O)C(C)C1OC(CCC1C)CC2OC3(OC(C)(CC3C)C4OC(C)(CC4)C5OC(CC5C)C6OC(O)(CO)C(C)CC6C)C(C)C(OC)C2 |
External Identifier | Value |
---|---|
28380-24-7 | |
4490 | |
4335 |
Name | Value |
---|---|
723.4689 | |
EQ368256 | |
2015.08.26 | |
Stravs M, Schymanski E, Singer H, Department of Environmental Chemistry, Eawag and Thomaidis N, University of Athens | |
CC BY | |
Copyright (C) 2015 Eawag, Duebendorf, Switzerland | |
724.47616 | |
Q Exactive Plus Orbitrap Thermo Scientific | |
LC-ESI-QFT | |
MS2 | |
ESI | |
HCD | |
90 (nominal) | |
35000 | |
XBridge C18 3.5um, 2.1x50mm, Waters | |
0.8036213856274578 | |
90/10 at 0 min, 50/50 at 4 min, 5/95 at 17 min, 5/95 at 25 min, 90/10 at 25.1 min, 90/10 at 30 min | |
200 ul/min | |
19.7 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.9.6 | |
negative | |
2.8797924547443357 | |
[M-H]- | |
0.017974511466302686 ppm | |
1.300400003856339E-5 Da |