Name | Value |
---|---|
Natural Product; Steroid hormone | |
InChI=1S/C18H24O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13?,14?,15?,16-,17+,18?/m1/s1 | |
PROQIPRRNZUXQM-SBZGPEHISA-N | |
C18H24O3 | |
288.17254462799997 | |
OC1=CC=C2C(=C1)CCC3C2CCC4(C)C(O)C(O)CC34 |
Name | Value |
---|---|
FFF00131 | |
2016.01.19 (Created 2011.03.01, modified 2011.06.20) | |
Atsushi Yamamoto, PFOS.jp | |
CC BY-SA | |
PFOS.jp | |
Disclaimer: While authors make an effort to ensure that the content of this record is accurate, the authors make no representations or warranties in relation to the accuracy or completeness of the record. This record do not reflect any viewpoints of the affiliation and organization to which the authors belong. | |
288.17254 | |
API2000 | |
LC-APPI-QQ | |
MS2 | |
0.820833 min | |
positive | |
3.7892788076443593 | |
0.6919207572025028 | |
253.2 | |
[M-2H2O+H]+ |