Name | Value |
---|---|
68152 | |
InChI=1S/C6H10O5/c7-5(8)1-3-11-4-2-6(9)10/h1-4H2,(H,7,8)(H,9,10) | |
FOSIWKADJDNVMJ-UHFFFAOYSA-N | |
C6H10O5 | |
162.05282341999998 | |
O=C(O)CCOCCC(=O)O |
Name | Value |
---|---|
506097 | |
dimer 1 | |
2 TMS | |
#REF! | |
MS1 | |
Leco Pegasus IV | |
GC-EI-TOF | |
250C | |
230C | |
-70 eV | |
80-500 Da | |
Restek Corporation Rtx-5Sil MS (30 m length x 0.25 mm internal diameter with 0.25 µm film made of 95% dimethyl/5%diphenylpolysiloxane) | |
10m | |
helium | |
50-330°C | |
1 mL min-1 | |
0.5 µL | |
25 splitless time into a multi-baffled glass liner | |
50°C ramped to 250°C by 12°C s-1 | |
50°C for 1 min, then ramped at 20°C min-1 to 330°C, held constant for 5 min. | |
1800 V | |
positive | |
3.234000033121627 | |
0.7169365457845582 |