Name | Value |
---|---|
4840 | |
C17H19NO3 | |
285.13649346799997 | |
O=C(C=CC=CC1=CC=C2OCOC2=C1)N3CCCCC3 | |
InChI=1S/C17H19NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h2-3,6-9,12H,1,4-5,10-11,13H2/b6-2+,7-3? | |
MXXWOMGUGJBKIW-SRRWRRMSSA-N |
Name | Value |
---|---|
051104bylcs11 | |
1020318 | |
major | |
285.136 | |
MS1 | |
Leco Pegasus IV | |
GC-EI-TOF | |
250C | |
230C | |
-70 eV | |
80-500 Da | |
Restek Corporation Rtx-5Sil MS (30 m length x 0.25 mm internal diameter with 0.25 µm film made of 95% dimethyl/5%diphenylpolysiloxane) | |
10m | |
helium | |
50-330°C | |
1 mL min-1 | |
0.5 µL | |
25 splitless time into a multi-baffled glass liner | |
50°C ramped to 250°C by 12°C s-1 | |
50°C for 1 min, then ramped at 20°C min-1 to 330°C, held constant for 5 min. | |
1800 V | |
positive | |
3.2575517160022995 | |
0.6957412250922959 |