Name | Value |
---|---|
HZJKXKUJVSEEFU-UHFFFAOYSA-N | |
6336 | |
C15H17ClN4 | |
288.114174224 | |
N#CC(C1=CC=C(Cl)C=C1)(CN2N=CN=C2)CCCC | |
InChI=1S/C15H17ClN4/c1-2-3-8-15(9-17,10-20-12-18-11-19-20)13-4-6-14(16)7-5-13/h4-7,11-12H,2-3,8,10H2,1H3 |
Name | Value |
---|---|
45788 | |
843684 | |
2210 | |
288.11417 | |
MS1 | |
Leco Pegasus IV | |
GC-EI-TOF | |
250C | |
230C | |
-70 eV | |
80-500 Da | |
Restek Corporation Rtx-5Sil MS (30 m length x 0.25 mm internal diameter with 0.25 µm film made of 95% dimethyl/5%diphenylpolysiloxane) | |
10m | |
helium | |
50-330°C | |
1 mL min-1 | |
0.5 µL | |
25 splitless time into a multi-baffled glass liner | |
50°C ramped to 250°C by 12°C s-1 | |
50°C for 1 min, then ramped at 20°C min-1 to 330°C, held constant for 5 min. | |
1800 V | |
positive | |
4.132817324022285 | |
0.7267162357957178 |