Name | Value |
---|---|
InChI=1S/C10H24N2O2/c1-3-9(7-13)11-5-6-12-10(4-2)8-14/h9-14H,3-8H2,1-2H3/t9-,10-/m0/s1 | |
AEUTYOVWOVBAKS-UWVGGRQHSA-N | |
C10H24N2O2 | |
204.183778008 | |
OCC(NCCNC(CO)CC)CC |
External Identifier | Value |
---|---|
74-55-5 | |
14052 |
Name | Value |
---|---|
204.1838 | |
HB002335 | |
2020.02.20 | |
Laurent Debrauwer, Emilien L. Jamin, Research Centre in Food Toxicology (TOXALIM), INRAE, MetaboHUB-Metatoul platform, Toulouse, France | |
CC0 | |
Copyright (c) 2000 by Research Centre in Food Toxicology (TOXALIM), INRAE, MetaboHUB-Metatoul platform, Toulouse, France | |
Oberacher H, Sasse M, Antignac J-P, Guitton Y, Debrauwer L, Jamin E L, Schulze T, Krauss M, Covaci A, Caballero-Casero N, Rosseau K, Damont A, Fenaille F, Lamoree M, Schymanski E, A European proposal for quality control and quality assurance of tandem mass spectral libraries, Environmental Sciences Europe, https://doi.org/10.1186/s12302-020-00314-9 | |
LTQ Orbitrap XL Thermo Fisher Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
25% (nominal) | |
7500 | |
Hypersil GOLD C18 1.9 um 100 x 2.1 mm Thermo Fisher Scientific | |
100/0 at 0 min, 0/100 at 30 min, 0/100 at 35 min | |
300 uL/min | |
water with 5% methanol and 0.1% acetic acid | |
methanol with 0.1% acetic acid | |
positive | |
0.6074870810846232 | |
0.4382092996424488 | |
205.1911 | |
[M+H]+ | |
3.1580706959739318 ppm | |
-6.480079999846566E-4 Da |