Name | Value |
---|---|
Natural Product | |
InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7) | |
BTCSSZJGUNDROE-UHFFFAOYSA-N | |
C4H9NO2 | |
103.063328528 | |
O=C(O)CCCN |
Name | Value |
---|---|
KNA00005 | |
2016.01.19 (Created 2009.11.16, modified 2011.08.03) | |
Takahashi H, Kanaya S, Ogasawara N, Graduate School of Information Science, NAIST | |
CC BY-SA | |
[Spectral] 4-Aminobutanoate (exact mass = 103.06333) and D-2-Aminobutyrate (exact mass = 103.06333) were not completely separated on HPLC under the present analytical conditions as described in "AC$XXX". Additionally some of the peaks in this data contains dimers and other unidentified ions. | |
103.06333 | |
LTQ Orbitrap XL, Thermo Scientfic | |
LC-ESI-ITFT | |
MS1 | |
35eV | |
ESI | |
TOSOH TSKgel ODS-100V 5um Part no. 21456 | |
0min:3%, 45min:97%, 50min:97%, 50.1:3%, 57min:3% (acetonitrile) | |
0.5 ml/min | |
5.057092 min | |
0.1%formate-water / 0.1%formate-acetonitrile | |
positive | |
0.7496748449242416 | |
0.21440675638345205 |