Name | Value |
---|---|
Natural Product | |
InChI=1S/C8H11NO/c9-6-5-7-1-3-8(10)4-2-7/h1-4,10H,5-6,9H2 | |
DZGWFCGJZKJUFP-UHFFFAOYSA-N | |
C8H11NO | |
137.084063972 | |
OC1=CC=C(C=C1)CCN |
Name | Value |
---|---|
1.467559948552404 | |
0.3751409300293184 | |
KNA00081 | |
2016.01.19 (Created 2009.11.17, modified 2011.08.03) | |
Takahashi H, Kanaya S, Ogasawara N, Graduate School of Information Science, NAIST | |
CC BY-SA | |
[Spectral] Tyramine (exact mass = 137.08406) and L-Methionine (exact mass = 149.05105) were not completely separated on HPLC under the present analytical conditions as described in "AC$XXX". Additionally some of the peaks in this data contains dimers and other unidentified ions. | |
137.08406 | |
LTQ Orbitrap XL, Thermo Scientfic | |
LC-ESI-ITFT | |
MS1 | |
35eV | |
ESI | |
TOSOH TSKgel ODS-100V 5um Part no. 21456 | |
0min:3%, 45min:97%, 50min:97%, 50.1:3%, 57min:3% (acetonitrile) | |
0.5 ml/min | |
5.463565 min | |
0.1%formate-water / 0.1%formate-acetonitrile | |
positive |