Name | Value |
---|---|
Natural Product | |
InChI=1S/C5H5N5O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11) | |
UYTPUPDQBNUYGX-UHFFFAOYSA-N | |
C5H5N5O | |
151.04940978000002 | |
N=C1N=C(O)C=2N=CNC2N1 |
Name | Value |
---|---|
KNA00165 | |
2016.01.19 (Created 2009.11.17, modified 2011.08.03) | |
Takahashi H, Kanaya S, Ogasawara N, Graduate School of Information Science, NAIST | |
CC BY-SA | |
[Spectral] Guanine (exact mass = 151.04941) and 3,4-Dihydroxy-L-phenylalanine (exact mass = 197.06881) were not completely separated on HPLC under the present analytical conditions as described in "AC$XXX". Additionally some of the peaks in this data contains dimers and other unidentified ions. | |
151.04941 | |
LTQ Orbitrap XL, Thermo Scientfic | |
LC-ESI-ITFT | |
MS1 | |
35eV | |
ESI | |
TOSOH TSKgel ODS-100V 5um Part no. 21456 | |
0min:3%, 45min:97%, 50min:97%, 50.1:3%, 57min:3% (acetonitrile) | |
0.5 ml/min | |
5.473787 min | |
0.1%formate-water / 0.1%formate-acetonitrile | |
positive | |
1.8913459744072083 | |
0.44518020302521844 |