Name | Value |
---|---|
Natural Product | |
InChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 | |
UDMBCSSLTHHNCD-KQYNXXCUSA-N | |
C10H14N5O7P | |
347.063084418 | |
O=P(O)(O)OCC1OC(N2C=NC=3C(=NC=NC32)N)C(O)C1O |
Name | Value |
---|---|
KNA00447 | |
2016.01.19 (Created 2009.11.18, modified 2011.08.03) | |
Takahashi H, Kanaya S, Ogasawara N, Graduate School of Information Science, NAIST | |
CC BY-SA | |
[Spectral] AMP (exact mass = 347.06308) and Adenine (exact mass = 135.0545) were not completely separated on HPLC under the present analytical conditions as described in "AC$XXX". Additionally some of the peaks in this data contains dimers and other unidentified ions. | |
347.06308 | |
LTQ Orbitrap XL, Thermo Scientfic | |
LC-ESI-ITFT | |
MS1 | |
35eV | |
ESI | |
TOSOH TSKgel ODS-100V 5um Part no. 21456 | |
0min:3%, 45min:97%, 50min:97%, 50.1:3%, 57min:3% (acetonitrile) | |
0.5 ml/min | |
8.618435 min | |
0.1%formate-water / 0.1%formate-acetonitrile | |
positive | |
1.5601790753444378 | |
0.36025747898883215 |