Name | Value |
---|---|
Natural Product | |
InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5- | |
HEBKCHPVOIAQTA-ZXFHETKHSA-N | |
C5H12O5 | |
152.06847348399998 | |
OCC(O)C(O)C(O)CO |
Name | Value |
---|---|
KNA00451 | |
2016.01.19 (Created 2009.11.18, modified 2011.08.03) | |
Takahashi H, Kanaya S, Ogasawara N, Graduate School of Information Science, NAIST | |
CC BY-SA | |
[Spectral] Ribitol (exact mass = 152.06847) and L-Citrulline (exact mass = 175.09569) were not completely separated on HPLC under the present analytical conditions as described in "AC$XXX". Additionally some of the peaks in this data contains dimers and other unidentified ions. | |
152.06847 | |
LTQ Orbitrap XL, Thermo Scientfic | |
LC-ESI-ITFT | |
MS1 | |
35eV | |
ESI | |
TOSOH TSKgel ODS-100V 5um Part no. 21456 | |
0min:3%, 45min:97%, 50min:97%, 50.1:3%, 57min:3% (acetonitrile) | |
0.5 ml/min | |
5.042210 min | |
0.1%formate-water / 0.1%formate-acetonitrile | |
positive | |
3.369911382578929 | |
0.6081485486326175 |