Name | Value |
---|---|
Natural Product | |
InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1 | |
OUYCCCASQSFEME-QMMMGPOBSA-N | |
C9H11NO3 | |
181.07389321199997 | |
O=C(O)C(N)CC1=CC=C(O)C=C1 |
Name | Value |
---|---|
KNA00572 | |
2016.01.19 (Created 2009.11.18, modified 2011.08.03) | |
Takahashi H, Kanaya S, Ogasawara N, Graduate School of Information Science, NAIST | |
CC BY-SA | |
[Spectral] L-Tyrosine (exact mass = 181.07389) and Glutathione disulfide (exact mass = 612.15196) and AMP (exact mass = 347.06308) were not completely separated on HPLC under the present analytical conditions as described in "AC$XXX". Additionally some of the peaks in this data contains dimers and other unidentified ions. | |
181.07389 | |
LTQ Orbitrap XL, Thermo Scientfic | |
LC-ESI-ITFT | |
MS1 | |
35eV | |
ESI | |
TOSOH TSKgel ODS-100V 5um Part no. 21456 | |
0min:3%, 45min:97%, 50min:97%, 50.1:3%, 57min:3% (acetonitrile) | |
0.5 ml/min | |
9.356410 min | |
0.1%formate-water / 0.1%formate-acetonitrile | |
negative | |
4.2307146309297465 | |
0.665796074790582 |