Name | Value |
---|---|
InChI=1S/C11H23NO2/c12-10-8-6-4-2-1-3-5-7-9-11(13)14/h1-10,12H2,(H,13,14) | |
GUOSQNAUYHMCRU-UHFFFAOYSA-N | |
C11H23NO2 | |
201.172878976 | |
O=C(O)CCCCCCCCCCN |
External Identifier | Value |
---|---|
2432-99-7 | |
82387 | |
C19325 | |
LMFA01100004 | |
17083 | |
16168 |
Name | Value |
---|---|
2017.03.12 | |
identity | |
KW100602 | |
Erik Emke, Andrea Brunner, KWR | |
CC BY | |
Copyright (C) 2017 KWR watercycle research institute | |
201.1729 | |
Orbitrap Classic, Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 eV FT-MS | |
7500 | |
XBridge C18 3.5um, 2.1x150mm, Waters | |
95/5 at 0 min, 0/100 at 40 min, 0/100 at 45 min, 95/5 at 47 min, 95/5 at 52 min | |
300 uL/min | |
9.922 min | |
water with 0.05% formic acid | |
acetonitrile with 0.05% formic acid | |
Peaks with additional N2/O included | |
RMassBank 2.2.0 | |
positive | |
0.14652524668843206 | |
0.13337302722698496 | |
202.1802 | |
[M+H]+ | |
3.2098889999094085 ppm | |
-6.489759999794842E-4 Da |