Name | Value |
---|---|
InChI=1S/C16H20N2O3/c1-9(2)16(4)15(20)17-13(18-16)12-8-10(3)6-7-11(12)14(19)21-5/h6-9H,1-5H3,(H,17,18,20) | |
FFCCBBNQPIMUJI-UHFFFAOYSA-N | |
C16H20N2O3 | |
288.14739249999997 | |
O=C(OC)C=1C=CC(=CC1C2=NC(=O)C(N2)(C)C(C)C)C |
External Identifier | Value |
---|---|
81405-85-8 | |
6849 | |
C11494 | |
54744 | |
49450 |
Name | Value |
---|---|
KW106301 | |
2017.03.12 | |
Erik Emke, Andrea Brunner, KWR | |
CC BY | |
Copyright (C) 2017 KWR watercycle research institute | |
288.1474 | |
Orbitrap Classic, Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 eV IT-MS | |
nominal | |
XBridge C18 3.5um, 2.1x150mm, Waters | |
95/5 at 0 min, 0/100 at 40 min, 0/100 at 45 min, 95/5 at 47 min, 95/5 at 52 min | |
300 uL/min | |
11.605 min | |
water with 0.05% formic acid | |
acetonitrile with 0.05% formic acid | |
identity | |
Peaks with additional N2/O included | |
RMassBank 2.2.0 | |
positive | |
0.41549160771870614 | |
0.29971384099337994 | |
289.1547 | |
[M+H]+ | |
2.2911610981104835 ppm | |
-6.624999999758074E-4 Da |