Name | Value |
---|---|
InChI=1S/C15H12N2O2/c16-15(18)17-11-7-3-1-5-9(11)13-14(19-13)10-6-2-4-8-12(10)17/h1-8,13-14H,(H2,16,18) | |
ZRWWEEVEIOGMMT-UHFFFAOYSA-N | |
C15H12N2O2 | |
252.089877624 | |
N=C(O)N1C=2C=CC=CC2C3OC3C=4C=CC=CC41 |
External Identifier | Value |
---|---|
36507-30-9 | |
3388 | |
C07496 | |
2555 | |
2458 |
Name | Value |
---|---|
CC BY | |
KW107302 | |
2017.03.12 | |
Erik Emke, Andrea Brunner, KWR | |
Copyright (C) 2017 KWR watercycle research institute | |
252.0899 | |
Orbitrap Classic, Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 eV FT-MS | |
7500 | |
XBridge C18 3.5um, 2.1x150mm, Waters | |
95/5 at 0 min, 0/100 at 40 min, 0/100 at 45 min, 95/5 at 47 min, 95/5 at 52 min | |
300 uL/min | |
12.085 min | |
water with 0.05% formic acid | |
acetonitrile with 0.05% formic acid | |
identity | |
Peaks with additional N2/O included | |
RMassBank 2.2.0 | |
positive | |
0.8872865684611754 | |
0.5513021419504469 | |
253.0972 | |
[M+H]+ | |
2.55879559319395 ppm | |
-6.476240000097278E-4 Da |