Name | Value |
---|---|
InChI=1S/C25H28N6O/c1-2-3-10-22-26-25(15-6-7-16-25)24(32)31(22)17-18-11-13-19(14-12-18)20-8-4-5-9-21(20)23-27-29-30-28-23/h4-5,8-9,11-14H,2-3,6-7,10,15-17H2,1H3,(H,27,28,29,30) | |
YOSHYTLCDANDAN-UHFFFAOYSA-N | |
C25H28N6O | |
428.23245951599995 | |
O=C1N(C(=NC12CCCC2)CCCC)CC3=CC=C(C=C3)C4=CC=CC=C4C=5N=NNN5 |
External Identifier | Value |
---|---|
138402-11-6 | |
5959 | |
D00523 | |
3749 | |
3618 |
Name | Value |
---|---|
KW107401 | |
2017.03.12 | |
Erik Emke, Andrea Brunner, KWR | |
CC BY | |
Copyright (C) 2017 KWR watercycle research institute | |
428.2325 | |
Orbitrap Classic, Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 eV IT-MS | |
nominal | |
XBridge C18 3.5um, 2.1x150mm, Waters | |
95/5 at 0 min, 0/100 at 40 min, 0/100 at 45 min, 95/5 at 47 min, 95/5 at 52 min | |
300 uL/min | |
16.137 min | |
water with 0.05% formic acid | |
acetonitrile with 0.05% formic acid | |
identity | |
Peaks with additional N2/O included | |
RMassBank 2.2.0 | |
positive | |
0.41580357995048944 | |
0.18058120032811514 | |
429.2397 | |
[M+H]+ | |
1.6995538854436327 ppm | |
-7.295159999216594E-4 Da |